C24H31F3N6O2 — CID 170433645
3-[1-methyl-7-[4-[[(2S)-2-(trifluoromethyl)piperazin-1-yl]methyl]piperidin-1-yl]indazol-3-yl]piperidine-2,6-dione (PubChem CID 170433645) has the molecular formula C24H31F3N6O2 and a molecular weight of 492.55 g/mol. Its IUPAC name is 3-[1-methyl-7-[4-[[(2S)-2-(trifluoromethyl)piperazin-1-yl]methyl]piperidin-1-yl]indazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[1-methyl-7-[4-[[(2S)-2-(trifluoromethyl)piperazin-1-yl]methyl]piperidin-1-yl]indazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170433645 |
| Molecular Formula | C24H31F3N6O2 |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 3-[1-methyl-7-[4-[[(2S)-2-(trifluoromethyl)piperazin-1-yl]methyl]piperidin-1-yl]indazol-3-yl]piperidine-2,6-dione |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2cccc(N3CCC(CN4CCNC[C@H]4C(F)(F)F)CC3)c21 |
| InChI | InChI=1S/C24H31F3N6O2/c1-31-22-16(21(30-31)17-5-6-20(34)29-23(17)35)3-2-4-18(22)32-10-7-15(8-11-32)14-33-12-9-28-13-19(33)24(25,26)27/h2-4,15,17,19,28H,5-14H2,1H3,(H,29,34,35)/t17?,19-/m0/s1 |
| InChIKey | FYKIBITWCUZBTD-NNBQYGFHSA-N |
| XLogP | 2.15 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|