C28H41N5O2 — CID 175632812
3-[7-[4-[(2R)-5-cyclohexylpentan-2-yl]piperazin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione (PubChem CID 175632812) has the molecular formula C28H41N5O2 and a molecular weight of 479.67 g/mol. Its IUPAC name is 3-[7-[4-[(2R)-5-cyclohexylpentan-2-yl]piperazin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[4-[(2R)-5-cyclohexylpentan-2-yl]piperazin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 175632812 |
| Molecular Formula | C28H41N5O2 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.33 |
| IUPAC Name | 3-[7-[4-[(2R)-5-cyclohexylpentan-2-yl]piperazin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione |
| SMILES | C[C@H](CCCC1CCCCC1)N1CCN(c2cccc3c(C4CCC(=O)NC4=O)nn(C)c23)CC1 |
| InChI | InChI=1S/C28H41N5O2/c1-20(8-6-11-21-9-4-3-5-10-21)32-16-18-33(19-17-32)24-13-7-12-22-26(30-31(2)27(22)24)23-14-15-25(34)29-28(23)35/h7,12-13,20-21,23H,3-6,8-11,14-19H2,1-2H3,(H,29,34,35)/t20-,23?/m1/s1 |
| InChIKey | ASAACJNWUJMONP-PPUHSXQSSA-N |
| XLogP | 4.35 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|