C27H31N7O4 — CID 177363298
3-[1-methyl-7-[4-[1-[(4-nitrophenyl)methyl]azetidin-3-yl]piperazin-1-yl]indazol-3-yl]piperidine-2,6-dione (PubChem CID 177363298) has the molecular formula C27H31N7O4 and a molecular weight of 517.59 g/mol. Its IUPAC name is 3-[1-methyl-7-[4-[1-[(4-nitrophenyl)methyl]azetidin-3-yl]piperazin-1-yl]indazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[1-methyl-7-[4-[1-[(4-nitrophenyl)methyl]azetidin-3-yl]piperazin-1-yl]indazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177363298 |
| Molecular Formula | C27H31N7O4 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | 3-[1-methyl-7-[4-[1-[(4-nitrophenyl)methyl]azetidin-3-yl]piperazin-1-yl]indazol-3-yl]piperidine-2,6-dione |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2cccc(N3CCN(C4CN(Cc5ccc([N+](=O)[O-])cc5)C4)CC3)c21 |
| InChI | InChI=1S/C27H31N7O4/c1-30-26-21(25(29-30)22-9-10-24(35)28-27(22)36)3-2-4-23(26)33-13-11-32(12-14-33)20-16-31(17-20)15-18-5-7-19(8-6-18)34(37)38/h2-8,20,22H,9-17H2,1H3,(H,28,35,36) |
| InChIKey | MGUHISUXRVOZOA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 116.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|