C28H32ClFN6O2 — CID 178164783
3-[7-[4-[1-(4-chloro-3-fluorophenyl)piperidin-4-yl]piperazin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione (PubChem CID 178164783) has the molecular formula C28H32ClFN6O2 and a molecular weight of 539.06 g/mol. Its IUPAC name is 3-[7-[4-[1-(4-chloro-3-fluorophenyl)piperidin-4-yl]piperazin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[4-[1-(4-chloro-3-fluorophenyl)piperidin-4-yl]piperazin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 178164783 |
| Molecular Formula | C28H32ClFN6O2 |
| Molecular Weight | 539.06 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | 3-[7-[4-[1-(4-chloro-3-fluorophenyl)piperidin-4-yl]piperazin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2cccc(N3CCN(C4CCN(c5ccc(Cl)c(F)c5)CC4)CC3)c21 |
| InChI | InChI=1S/C28H32ClFN6O2/c1-33-27-20(26(32-33)21-6-8-25(37)31-28(21)38)3-2-4-24(27)36-15-13-35(14-16-36)18-9-11-34(12-10-18)19-5-7-22(29)23(30)17-19/h2-5,7,17-18,21H,6,8-16H2,1H3,(H,31,37,38) |
| InChIKey | UAXIOEGGEFYOAA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 73.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.06 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|