C35H47BN6O4 — CID 178164896
3-[1-methyl-7-[(3S)-3-methyl-4-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-4-yl]piperazin-1-yl]indazol-3-yl]piperidine-2,6-dione (PubChem CID 178164896) has the molecular formula C35H47BN6O4 and a molecular weight of 626.61 g/mol. Its IUPAC name is 3-[1-methyl-7-[(3S)-3-methyl-4-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-4-yl]piperazin-1-yl]indazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[1-methyl-7-[(3S)-3-methyl-4-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-4-yl]piperazin-1-yl]indazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 178164896 |
| Molecular Formula | C35H47BN6O4 |
| Molecular Weight | 626.61 g/mol |
| Exact Mass | 626.38 |
| IUPAC Name | 3-[1-methyl-7-[(3S)-3-methyl-4-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-4-yl]piperazin-1-yl]indazol-3-yl]piperidine-2,6-dione |
| SMILES | C[C@H]1CN(c2cccc3c(C4CCC(=O)NC4=O)nn(C)c23)CCN1C1CCN(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)CC1 |
| InChI | InChI=1S/C35H47BN6O4/c1-23-22-41(29-9-7-8-27-31(38-39(6)32(27)29)28-14-15-30(43)37-33(28)44)20-21-42(23)26-16-18-40(19-17-26)25-12-10-24(11-13-25)36-45-34(2,3)35(4,5)46-36/h7-13,23,26,28H,14-22H2,1-6H3,(H,37,43,44)/t23-,28?/m0/s1 |
| InChIKey | OFFLVGJSBOUOMY-UHFKCPIBSA-N |
| XLogP | 3.57 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.61 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|