C26H36N6O4 — CID 170433212
tert-butyl 4-[1-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-7-yl]pyrrolidin-3-yl]piperazine-1-carboxylate (PubChem CID 170433212) has the molecular formula C26H36N6O4 and a molecular weight of 496.61 g/mol. Its IUPAC name is tert-butyl 4-[1-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-7-yl]pyrrolidin-3-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-7-yl]pyrrolidin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170433212 |
| Molecular Formula | C26H36N6O4 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | tert-butyl 4-[1-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-7-yl]pyrrolidin-3-yl]piperazine-1-carboxylate |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2cccc(N3CCC(N4CCN(C(=O)OC(C)(C)C)CC4)C3)c21 |
| InChI | InChI=1S/C26H36N6O4/c1-26(2,3)36-25(35)31-14-12-30(13-15-31)17-10-11-32(16-17)20-7-5-6-18-22(28-29(4)23(18)20)19-8-9-21(33)27-24(19)34/h5-7,17,19H,8-16H2,1-4H3,(H,27,33,34) |
| InChIKey | PEZCKMARLJYDPG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|