C22H28FN5O4 — CID 170322178
tert-butyl 4-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-1-methylindazol-6-yl]piperazine-1-carboxylate (PubChem CID 170322178) has the molecular formula C22H28FN5O4 and a molecular weight of 445.50 g/mol. Its IUPAC name is tert-butyl 4-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-1-methylindazol-6-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-1-methylindazol-6-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170322178 |
| Molecular Formula | C22H28FN5O4 |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | tert-butyl 4-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-1-methylindazol-6-yl]piperazine-1-carboxylate |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2cc(F)c(N3CCN(C(=O)OC(C)(C)C)CC3)cc21 |
| InChI | InChI=1S/C22H28FN5O4/c1-22(2,3)32-21(31)28-9-7-27(8-10-28)17-12-16-14(11-15(17)23)19(25-26(16)4)13-5-6-18(29)24-20(13)30/h11-13H,5-10H2,1-4H3,(H,24,29,30) |
| InChIKey | XKZRKEUKBRVBBH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|