C23H31N5O4 — CID 170629691
tert-butyl (3R)-3-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]amino]piperidine-1-carboxylate (PubChem CID 170629691) has the molecular formula C23H31N5O4 and a molecular weight of 441.53 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170629691 |
| Molecular Formula | C23H31N5O4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | tert-butyl (3R)-3-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]amino]piperidine-1-carboxylate |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2ccc(N[C@@H]3CCCN(C(=O)OC(C)(C)C)C3)cc21 |
| InChI | InChI=1S/C23H31N5O4/c1-23(2,3)32-22(31)28-11-5-6-15(13-28)24-14-7-8-16-18(12-14)27(4)26-20(16)17-9-10-19(29)25-21(17)30/h7-8,12,15,17,24H,5-6,9-11,13H2,1-4H3,(H,25,29,30)/t15-,17?/m1/s1 |
| InChIKey | BLOOVSYDOSVZRA-LDCVWXEPSA-N |
| XLogP | 2.90 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|