C24H32N4O4 — CID 170617163
tert-butyl (2S,4S)-4-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]-2-methylpiperidine-1-carboxylate (PubChem CID 170617163) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]-2-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]-2-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 170617163 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | tert-butyl (2S,4S)-4-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]-2-methylpiperidine-1-carboxylate |
| SMILES | C[C@H]1C[C@@H](c2ccc3c(C4CCC(=O)NC4=O)nn(C)c3c2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H32N4O4/c1-14-12-16(10-11-28(14)23(31)32-24(2,3)4)15-6-7-17-19(13-15)27(5)26-21(17)18-8-9-20(29)25-22(18)30/h6-7,13-14,16,18H,8-12H2,1-5H3,(H,25,29,30)/t14-,16-,18?/m0/s1 |
| InChIKey | FQVCVQQHYCWMCN-CCLCZBONSA-N |
| XLogP | 3.60 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|