C26H33N7O4 — CID 178161301
tert-butyl 4-[1-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]methyl]triazol-4-yl]piperidine-1-carboxylate (PubChem CID 178161301) has the molecular formula C26H33N7O4 and a molecular weight of 507.60 g/mol. Its IUPAC name is tert-butyl 4-[1-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]methyl]triazol-4-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]methyl]triazol-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 178161301 |
| Molecular Formula | C26H33N7O4 |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | tert-butyl 4-[1-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]methyl]triazol-4-yl]piperidine-1-carboxylate |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2ccc(Cn3cc(C4CCN(C(=O)OC(C)(C)C)CC4)nn3)cc21 |
| InChI | InChI=1S/C26H33N7O4/c1-26(2,3)37-25(36)32-11-9-17(10-12-32)20-15-33(30-28-20)14-16-5-6-18-21(13-16)31(4)29-23(18)19-7-8-22(34)27-24(19)35/h5-6,13,15,17,19H,7-12,14H2,1-4H3,(H,27,34,35) |
| InChIKey | NMBNGVNXELTCSV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 124.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|