C24H28N6O4 — CID 178161118
methyl 4-[1-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]methyl]pyrazol-3-yl]piperidine-1-carboxylate (PubChem CID 178161118) has the molecular formula C24H28N6O4 and a molecular weight of 464.53 g/mol. Its IUPAC name is methyl 4-[1-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]methyl]pyrazol-3-yl]piperidine-1-carboxylate.
| Compound Name | methyl 4-[1-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]methyl]pyrazol-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 178161118 |
| Molecular Formula | C24H28N6O4 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | methyl 4-[1-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]methyl]pyrazol-3-yl]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(c2ccn(Cc3ccc4c(C5CCC(=O)NC5=O)nn(C)c4c3)n2)CC1 |
| InChI | InChI=1S/C24H28N6O4/c1-28-20-13-15(3-4-17(20)22(27-28)18-5-6-21(31)25-23(18)32)14-30-12-9-19(26-30)16-7-10-29(11-8-16)24(33)34-2/h3-4,9,12-13,16,18H,5-8,10-11,14H2,1-2H3,(H,25,31,32) |
| InChIKey | LTAFFMMRJKXRNX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|