C28H40N4O4 — CID 178161203
3-(6-cyclohexyl-1-methylindazol-3-yl)piperidine-2,6-dione;ethyl 4-methylpiperidine-1-carboxylate (PubChem CID 178161203) has the molecular formula C28H40N4O4 and a molecular weight of 496.65 g/mol. Its IUPAC name is 3-(6-cyclohexyl-1-methylindazol-3-yl)piperidine-2,6-dione;ethyl 4-methylpiperidine-1-carboxylate.
| Compound Name | 3-(6-cyclohexyl-1-methylindazol-3-yl)piperidine-2,6-dione;ethyl 4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 178161203 |
| Molecular Formula | C28H40N4O4 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | 3-(6-cyclohexyl-1-methylindazol-3-yl)piperidine-2,6-dione;ethyl 4-methylpiperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(C)CC1.Cn1nc(C2CCC(=O)NC2=O)c2ccc(C3CCCCC3)cc21 |
| InChI | InChI=1S/C19H23N3O2.C9H17NO2/c1-22-16-11-13(12-5-3-2-4-6-12)7-8-14(16)18(21-22)15-9-10-17(23)20-19(15)24;1-3-12-9(11)10-6-4-8(2)5-7-10/h7-8,11-12,15H,2-6,9-10H2,1H3,(H,20,23,24);8H,3-7H2,1-2H3 |
| InChIKey | BSQBTOUSHJQUSC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|