About 2-[3-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]azetidin-1-yl]acetic acid
2-[3-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]azetidin-1-yl]acetic acid (PubChem CID 166168890) has the molecular formula C18H20N4O4
and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-[3-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]azetidin-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[3-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]azetidin-1-yl]acetic acid |
| PubChem CID | 166168890 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-[3-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]azetidin-1-yl]acetic acid |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2ccc(C3CN(CC(=O)O)C3)cc21 |
| InChI | InChI=1S/C18H20N4O4/c1-21-14-6-10(11-7-22(8-11)9-16(24)25)2-3-12(14)17(20-21)13-4-5-15(23)19-18(13)26/h2-3,6,11,13H,4-5,7-9H2,1H3,(H,24,25)(H,19,23,26) |
| InChIKey | RXAJURSTWWXHGM-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]azetidin-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]azetidin-1-yl]acetic acid?
The IUPAC name of 2-[3-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]azetidin-1-yl]acetic acid (CID 166168890) is 2-[3-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]azetidin-1-yl]acetic acid.
What is the SMILES notation for 2-[3-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]azetidin-1-yl]acetic acid?
The canonical SMILES for 2-[3-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]azetidin-1-yl]acetic acid is Cn1nc(C2CCC(=O)NC2=O)c2ccc(C3CN(CC(=O)O)C3)cc21.
What is the InChIKey of 2-[3-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]azetidin-1-yl]acetic acid?
The InChIKey is RXAJURSTWWXHGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4O4/c1-21-14-6-10(11-7-22(8-11)9-16(24)25)2-3-12(14)17(20-21)13-4-5-15(23)19-18(13)26/h2-3,6,11,13H,4-5,7-9H2,1H3,(H,24,25)(H,19,23,26).
What are the key properties of 2-[3-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]azetidin-1-yl]acetic acid?
2-[3-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]azetidin-1-yl]acetic acid has a molecular weight of 356.38 g/mol, XLogP of 0.58, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]azetidin-1-yl]acetic acid is sourced from PubChem (CID 166168890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).