C25H34N4O2 — CID 172591430
3-[6-[1-(cyclohexylmethyl)piperidin-4-yl]-1-methylindazol-3-yl]piperidine-2,6-dione (PubChem CID 172591430) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 3-[6-[1-(cyclohexylmethyl)piperidin-4-yl]-1-methylindazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[1-(cyclohexylmethyl)piperidin-4-yl]-1-methylindazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 172591430 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 3-[6-[1-(cyclohexylmethyl)piperidin-4-yl]-1-methylindazol-3-yl]piperidine-2,6-dione |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2ccc(C3CCN(CC4CCCCC4)CC3)cc21 |
| InChI | InChI=1S/C25H34N4O2/c1-28-22-15-19(18-11-13-29(14-12-18)16-17-5-3-2-4-6-17)7-8-20(22)24(27-28)21-9-10-23(30)26-25(21)31/h7-8,15,17-18,21H,2-6,9-14,16H2,1H3,(H,26,30,31) |
| InChIKey | OVKJQRGBYVZTKY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|