C27H39N5O2 — CID 175632297
3-[6-[4-(4-cyclohexylbutyl)piperazin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione (PubChem CID 175632297) has the molecular formula C27H39N5O2 and a molecular weight of 465.64 g/mol. Its IUPAC name is 3-[6-[4-(4-cyclohexylbutyl)piperazin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-(4-cyclohexylbutyl)piperazin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 175632297 |
| Molecular Formula | C27H39N5O2 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.31 |
| IUPAC Name | 3-[6-[4-(4-cyclohexylbutyl)piperazin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2ccc(N3CCN(CCCCC4CCCCC4)CC3)cc21 |
| InChI | InChI=1S/C27H39N5O2/c1-30-24-19-21(10-11-22(24)26(29-30)23-12-13-25(33)28-27(23)34)32-17-15-31(16-18-32)14-6-5-9-20-7-3-2-4-8-20/h10-11,19-20,23H,2-9,12-18H2,1H3,(H,28,33,34) |
| InChIKey | OHCOIQAMCUGZHI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|