C23H31FN6O2 — CID 170432425
3-[6-[4-[[(3R,4R)-3-fluoropiperidin-4-yl]methyl]piperazin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione (PubChem CID 170432425) has the molecular formula C23H31FN6O2 and a molecular weight of 442.54 g/mol. Its IUPAC name is 3-[6-[4-[[(3R,4R)-3-fluoropiperidin-4-yl]methyl]piperazin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[[(3R,4R)-3-fluoropiperidin-4-yl]methyl]piperazin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170432425 |
| Molecular Formula | C23H31FN6O2 |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 3-[6-[4-[[(3R,4R)-3-fluoropiperidin-4-yl]methyl]piperazin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2ccc(N3CCN(C[C@H]4CCNC[C@@H]4F)CC3)cc21 |
| InChI | InChI=1S/C23H31FN6O2/c1-28-20-12-16(2-3-17(20)22(27-28)18-4-5-21(31)26-23(18)32)30-10-8-29(9-11-30)14-15-6-7-25-13-19(15)24/h2-3,12,15,18-19,25H,4-11,13-14H2,1H3,(H,26,31,32)/t15-,18?,19+/m1/s1 |
| InChIKey | MVXVQKJXKAKZQN-JNBCYNBSSA-N |
| XLogP | 1.16 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|