C18H20F3N5O2 — CID 170321853
3-[1-methyl-6-[2-(trifluoromethyl)piperazin-1-yl]indazol-3-yl]piperidine-2,6-dione (PubChem CID 170321853) has the molecular formula C18H20F3N5O2 and a molecular weight of 395.39 g/mol. Its IUPAC name is 3-[1-methyl-6-[2-(trifluoromethyl)piperazin-1-yl]indazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[1-methyl-6-[2-(trifluoromethyl)piperazin-1-yl]indazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170321853 |
| Molecular Formula | C18H20F3N5O2 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 3-[1-methyl-6-[2-(trifluoromethyl)piperazin-1-yl]indazol-3-yl]piperidine-2,6-dione |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2ccc(N3CCNCC3C(F)(F)F)cc21 |
| InChI | InChI=1S/C18H20F3N5O2/c1-25-13-8-10(26-7-6-22-9-14(26)18(19,20)21)2-3-11(13)16(24-25)12-4-5-15(27)23-17(12)28/h2-3,8,12,14,22H,4-7,9H2,1H3,(H,23,27,28) |
| InChIKey | ZSOYWKZHOCJYAB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|