C18H22N4O2 — CID 170321838
3-[1-methyl-6-[(3R)-piperidin-3-yl]indazol-3-yl]piperidine-2,6-dione (PubChem CID 170321838) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 3-[1-methyl-6-[(3R)-piperidin-3-yl]indazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[1-methyl-6-[(3R)-piperidin-3-yl]indazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170321838 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 3-[1-methyl-6-[(3R)-piperidin-3-yl]indazol-3-yl]piperidine-2,6-dione |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2ccc([C@H]3CCCNC3)cc21 |
| InChI | InChI=1S/C18H22N4O2/c1-22-15-9-11(12-3-2-8-19-10-12)4-5-13(15)17(21-22)14-6-7-16(23)20-18(14)24/h4-5,9,12,14,19H,2-3,6-8,10H2,1H3,(H,20,23,24)/t12-,14?/m0/s1 |
| InChIKey | JHACCXUHKIACDS-NBFOIZRFSA-N |
| XLogP | 1.56 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|