C25H35N5O2 — CID 170432767
3-[1-methyl-6-[1-(1-piperidin-4-ylethyl)piperidin-4-yl]indazol-3-yl]piperidine-2,6-dione (PubChem CID 170432767) has the molecular formula C25H35N5O2 and a molecular weight of 437.59 g/mol. Its IUPAC name is 3-[1-methyl-6-[1-(1-piperidin-4-ylethyl)piperidin-4-yl]indazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[1-methyl-6-[1-(1-piperidin-4-ylethyl)piperidin-4-yl]indazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170432767 |
| Molecular Formula | C25H35N5O2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | 3-[1-methyl-6-[1-(1-piperidin-4-ylethyl)piperidin-4-yl]indazol-3-yl]piperidine-2,6-dione |
| SMILES | CC(C1CCNCC1)N1CCC(c2ccc3c(C4CCC(=O)NC4=O)nn(C)c3c2)CC1 |
| InChI | InChI=1S/C25H35N5O2/c1-16(17-7-11-26-12-8-17)30-13-9-18(10-14-30)19-3-4-20-22(15-19)29(2)28-24(20)21-5-6-23(31)27-25(21)32/h3-4,15-18,21,26H,5-14H2,1-2H3,(H,27,31,32) |
| InChIKey | AMBLYIRELXKBTR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|