C25H34N4O2 — CID 178160947
3-[1-methyl-6-[(4-piperidin-4-ylcyclohexyl)methyl]indazol-3-yl]piperidine-2,6-dione (PubChem CID 178160947) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 3-[1-methyl-6-[(4-piperidin-4-ylcyclohexyl)methyl]indazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[1-methyl-6-[(4-piperidin-4-ylcyclohexyl)methyl]indazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 178160947 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 3-[1-methyl-6-[(4-piperidin-4-ylcyclohexyl)methyl]indazol-3-yl]piperidine-2,6-dione |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2ccc(CC3CCC(C4CCNCC4)CC3)cc21 |
| InChI | InChI=1S/C25H34N4O2/c1-29-22-15-17(14-16-2-5-18(6-3-16)19-10-12-26-13-11-19)4-7-20(22)24(28-29)21-8-9-23(30)27-25(21)31/h4,7,15-16,18-19,21,26H,2-3,5-6,8-14H2,1H3,(H,27,30,31) |
| InChIKey | XDVIQRAMYZZBEQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|