C24H31N5O3 — CID 178160939
4-[1-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]piperidin-4-yl]piperidine-1-carbaldehyde (PubChem CID 178160939) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is 4-[1-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]piperidin-4-yl]piperidine-1-carbaldehyde.
| Compound Name | 4-[1-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]piperidin-4-yl]piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 178160939 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 4-[1-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]piperidin-4-yl]piperidine-1-carbaldehyde |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2ccc(N3CCC(C4CCN(C=O)CC4)CC3)cc21 |
| InChI | InChI=1S/C24H31N5O3/c1-27-21-14-18(2-3-19(21)23(26-27)20-4-5-22(31)25-24(20)32)29-12-8-17(9-13-29)16-6-10-28(15-30)11-7-16/h2-3,14-17,20H,4-13H2,1H3,(H,25,31,32) |
| InChIKey | WSTHRBPHJAOYGT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|