C26H35N5O5 — CID 178161660
ethyl 4-[1-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]piperidin-4-yl]oxypiperidine-1-carboxylate (PubChem CID 178161660) has the molecular formula C26H35N5O5 and a molecular weight of 497.60 g/mol. Its IUPAC name is ethyl 4-[1-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]piperidin-4-yl]oxypiperidine-1-carboxylate.
| Compound Name | ethyl 4-[1-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]piperidin-4-yl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 178161660 |
| Molecular Formula | C26H35N5O5 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | ethyl 4-[1-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]piperidin-4-yl]oxypiperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(OC2CCN(c3ccc4c(C5CCC(=O)NC5=O)nn(C)c4c3)CC2)CC1 |
| InChI | InChI=1S/C26H35N5O5/c1-3-35-26(34)31-14-10-19(11-15-31)36-18-8-12-30(13-9-18)17-4-5-20-22(16-17)29(2)28-24(20)21-6-7-23(32)27-25(21)33/h4-5,16,18-19,21H,3,6-15H2,1-2H3,(H,27,32,33) |
| InChIKey | WBTVZEJKAGEOMQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|