C28H38N4O4 — CID 178161715
ethyl 4-[[1-[3-(2,6-dioxopiperidin-3-yl)-1-methylindol-6-yl]piperidin-4-yl]methyl]piperidine-1-carboxylate (PubChem CID 178161715) has the molecular formula C28H38N4O4 and a molecular weight of 494.64 g/mol. Its IUPAC name is ethyl 4-[[1-[3-(2,6-dioxopiperidin-3-yl)-1-methylindol-6-yl]piperidin-4-yl]methyl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[1-[3-(2,6-dioxopiperidin-3-yl)-1-methylindol-6-yl]piperidin-4-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 178161715 |
| Molecular Formula | C28H38N4O4 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | ethyl 4-[[1-[3-(2,6-dioxopiperidin-3-yl)-1-methylindol-6-yl]piperidin-4-yl]methyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(CC2CCN(c3ccc4c(C5CCC(=O)NC5=O)cn(C)c4c3)CC2)CC1 |
| InChI | InChI=1S/C28H38N4O4/c1-3-36-28(35)32-14-10-20(11-15-32)16-19-8-12-31(13-9-19)21-4-5-22-24(18-30(2)25(22)17-21)23-6-7-26(33)29-27(23)34/h4-5,17-20,23H,3,6-16H2,1-2H3,(H,29,33,34) |
| InChIKey | RFCFKOISHSBBQF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|