C25H33F2N3O4 — CID 178161184
ethyl 4-[[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]piperidin-4-yl]methyl]piperidine-1-carboxylate (PubChem CID 178161184) has the molecular formula C25H33F2N3O4 and a molecular weight of 477.55 g/mol. Its IUPAC name is ethyl 4-[[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]piperidin-4-yl]methyl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]piperidin-4-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 178161184 |
| Molecular Formula | C25H33F2N3O4 |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | ethyl 4-[[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]piperidin-4-yl]methyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(CC2CCN(c3cc(F)c(C4CCC(=O)NC4=O)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C25H33F2N3O4/c1-2-34-25(33)30-11-7-17(8-12-30)13-16-5-9-29(10-6-16)18-14-20(26)23(21(27)15-18)19-3-4-22(31)28-24(19)32/h14-17,19H,2-13H2,1H3,(H,28,31,32) |
| InChIKey | LPKUXNHZVORAQP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|