C16H21F2NO2 — CID 172617426
butane;3-(2,6-difluoro-4-methylphenyl)piperidine-2,6-dione (PubChem CID 172617426) has the molecular formula C16H21F2NO2 and a molecular weight of 297.35 g/mol. Its IUPAC name is butane;3-(2,6-difluoro-4-methylphenyl)piperidine-2,6-dione.
| Compound Name | butane;3-(2,6-difluoro-4-methylphenyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 172617426 |
| Molecular Formula | C16H21F2NO2 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | butane;3-(2,6-difluoro-4-methylphenyl)piperidine-2,6-dione |
| SMILES | CCCC.Cc1cc(F)c(C2CCC(=O)NC2=O)c(F)c1 |
| InChI | InChI=1S/C12H11F2NO2.C4H10/c1-6-4-8(13)11(9(14)5-6)7-2-3-10(16)15-12(7)17;1-3-4-2/h4-5,7H,2-3H2,1H3,(H,15,16,17);3-4H2,1-2H3 |
| InChIKey | PPZGYLMNHKJTDS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|