C17H18F2N2O4 — CID 167264569
3-[4-[(3R)-2,6-dioxopiperidin-3-yl]-3,5-difluoro-N-methylanilino]cyclobutane-1-carboxylic acid (PubChem CID 167264569) has the molecular formula C17H18F2N2O4 and a molecular weight of 352.34 g/mol. Its IUPAC name is 3-[4-[(3R)-2,6-dioxopiperidin-3-yl]-3,5-difluoro-N-methylanilino]cyclobutane-1-carboxylic acid.
| Compound Name | 3-[4-[(3R)-2,6-dioxopiperidin-3-yl]-3,5-difluoro-N-methylanilino]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 167264569 |
| Molecular Formula | C17H18F2N2O4 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 3-[4-[(3R)-2,6-dioxopiperidin-3-yl]-3,5-difluoro-N-methylanilino]cyclobutane-1-carboxylic acid |
| SMILES | CN(c1cc(F)c([C@H]2CCC(=O)NC2=O)c(F)c1)C1CC(C(=O)O)C1 |
| InChI | InChI=1S/C17H18F2N2O4/c1-21(9-4-8(5-9)17(24)25)10-6-12(18)15(13(19)7-10)11-2-3-14(22)20-16(11)23/h6-9,11H,2-5H2,1H3,(H,24,25)(H,20,22,23)/t8?,9?,11-/m1/s1 |
| InChIKey | FBRZEHMCHFQASJ-NWGYLPEXSA-N |
| XLogP | 1.78 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|