C18H20F2N2O4 — CID 167264508
(3S)-1-[4-[(3R)-2,6-dioxopiperidin-3-yl]-3,5-difluorophenyl]-4,4-dimethylpyrrolidine-3-carboxylic acid (PubChem CID 167264508) has the molecular formula C18H20F2N2O4 and a molecular weight of 366.36 g/mol. Its IUPAC name is (3S)-1-[4-[(3R)-2,6-dioxopiperidin-3-yl]-3,5-difluorophenyl]-4,4-dimethylpyrrolidine-3-carboxylic acid.
| Compound Name | (3S)-1-[4-[(3R)-2,6-dioxopiperidin-3-yl]-3,5-difluorophenyl]-4,4-dimethylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 167264508 |
| Molecular Formula | C18H20F2N2O4 |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | (3S)-1-[4-[(3R)-2,6-dioxopiperidin-3-yl]-3,5-difluorophenyl]-4,4-dimethylpyrrolidine-3-carboxylic acid |
| SMILES | CC1(C)CN(c2cc(F)c([C@H]3CCC(=O)NC3=O)c(F)c2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C18H20F2N2O4/c1-18(2)8-22(7-11(18)17(25)26)9-5-12(19)15(13(20)6-9)10-3-4-14(23)21-16(10)24/h5-6,10-11H,3-4,7-8H2,1-2H3,(H,25,26)(H,21,23,24)/t10-,11+/m1/s1 |
| InChIKey | COJWIIXXISPSKO-MNOVXSKESA-N |
| XLogP | 2.03 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|