C23H24F2N4O3 — CID 170155759
1-(3,5-dimethylphenyl)-3-[1-[4-[(3R)-2,6-dioxopiperidin-3-yl]-3,5-difluorophenyl]azetidin-3-yl]urea (PubChem CID 170155759) has the molecular formula C23H24F2N4O3 and a molecular weight of 442.47 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[1-[4-[(3R)-2,6-dioxopiperidin-3-yl]-3,5-difluorophenyl]azetidin-3-yl]urea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[1-[4-[(3R)-2,6-dioxopiperidin-3-yl]-3,5-difluorophenyl]azetidin-3-yl]urea |
|---|---|
| PubChem CID | 170155759 |
| Molecular Formula | C23H24F2N4O3 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[1-[4-[(3R)-2,6-dioxopiperidin-3-yl]-3,5-difluorophenyl]azetidin-3-yl]urea |
| SMILES | Cc1cc(C)cc(NC(=O)NC2CN(c3cc(F)c([C@H]4CCC(=O)NC4=O)c(F)c3)C2)c1 |
| InChI | InChI=1S/C23H24F2N4O3/c1-12-5-13(2)7-14(6-12)26-23(32)27-15-10-29(11-15)16-8-18(24)21(19(25)9-16)17-3-4-20(30)28-22(17)31/h5-9,15,17H,3-4,10-11H2,1-2H3,(H2,26,27,32)(H,28,30,31)/t17-/m1/s1 |
| InChIKey | GYFVLBLBYCWVJL-QGZVFWFLSA-N |
| XLogP | 3.11 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|