C23H26N4O3 — CID 170156101
1-(3,5-dimethylphenyl)-3-[1-[4-[(3S)-2,6-dioxopiperidin-3-yl]phenyl]azetidin-3-yl]urea (PubChem CID 170156101) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[1-[4-[(3S)-2,6-dioxopiperidin-3-yl]phenyl]azetidin-3-yl]urea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[1-[4-[(3S)-2,6-dioxopiperidin-3-yl]phenyl]azetidin-3-yl]urea |
|---|---|
| PubChem CID | 170156101 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[1-[4-[(3S)-2,6-dioxopiperidin-3-yl]phenyl]azetidin-3-yl]urea |
| SMILES | Cc1cc(C)cc(NC(=O)NC2CN(c3ccc([C@@H]4CCC(=O)NC4=O)cc3)C2)c1 |
| InChI | InChI=1S/C23H26N4O3/c1-14-9-15(2)11-17(10-14)24-23(30)25-18-12-27(13-18)19-5-3-16(4-6-19)20-7-8-21(28)26-22(20)29/h3-6,9-11,18,20H,7-8,12-13H2,1-2H3,(H2,24,25,30)(H,26,28,29)/t20-/m0/s1 |
| InChIKey | DPRKHFLQHCTSPV-FQEVSTJZSA-N |
| XLogP | 2.83 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|