C22H23ClN4O3 — CID 170155963
1-(3-chloro-4-methylphenyl)-3-[1-[4-[(3R)-2,6-dioxopiperidin-3-yl]phenyl]azetidin-3-yl]urea (PubChem CID 170155963) has the molecular formula C22H23ClN4O3 and a molecular weight of 426.90 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[1-[4-[(3R)-2,6-dioxopiperidin-3-yl]phenyl]azetidin-3-yl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[1-[4-[(3R)-2,6-dioxopiperidin-3-yl]phenyl]azetidin-3-yl]urea |
|---|---|
| PubChem CID | 170155963 |
| Molecular Formula | C22H23ClN4O3 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[1-[4-[(3R)-2,6-dioxopiperidin-3-yl]phenyl]azetidin-3-yl]urea |
| SMILES | Cc1ccc(NC(=O)NC2CN(c3ccc([C@H]4CCC(=O)NC4=O)cc3)C2)cc1Cl |
| InChI | InChI=1S/C22H23ClN4O3/c1-13-2-5-15(10-19(13)23)24-22(30)25-16-11-27(12-16)17-6-3-14(4-7-17)18-8-9-20(28)26-21(18)29/h2-7,10,16,18H,8-9,11-12H2,1H3,(H2,24,25,30)(H,26,28,29)/t18-/m1/s1 |
| InChIKey | ZQQBZIDHBDYWMA-GOSISDBHSA-N |
| XLogP | 3.18 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|