C16H19N3O3 — CID 171063396
(3R)-1-[4-(2,6-dioxopiperidin-3-yl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 171063396) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is (3R)-1-[4-(2,6-dioxopiperidin-3-yl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-[4-(2,6-dioxopiperidin-3-yl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 171063396 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | (3R)-1-[4-(2,6-dioxopiperidin-3-yl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CCN(c2ccc(C3CCC(=O)NC3=O)cc2)C1 |
| InChI | InChI=1S/C16H19N3O3/c17-15(21)11-7-8-19(9-11)12-3-1-10(2-4-12)13-5-6-14(20)18-16(13)22/h1-4,11,13H,5-9H2,(H2,17,21)(H,18,20,22)/t11-,13?/m1/s1 |
| InChIKey | LTMAUZNTURMFBL-JTDNENJMSA-N |
| XLogP | 0.52 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|