C18H22N2O3 — CID 178005874
3-[4-[6-(hydroxymethyl)-2-azaspiro[3.3]heptan-2-yl]phenyl]piperidine-2,6-dione (PubChem CID 178005874) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 3-[4-[6-(hydroxymethyl)-2-azaspiro[3.3]heptan-2-yl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[6-(hydroxymethyl)-2-azaspiro[3.3]heptan-2-yl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 178005874 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 3-[4-[6-(hydroxymethyl)-2-azaspiro[3.3]heptan-2-yl]phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2ccc(N3CC4(CC(CO)C4)C3)cc2)C(=O)N1 |
| InChI | InChI=1S/C18H22N2O3/c21-9-12-7-18(8-12)10-20(11-18)14-3-1-13(2-4-14)15-5-6-16(22)19-17(15)23/h1-4,12,15,21H,5-11H2,(H,19,22,23) |
| InChIKey | IAGWKCOCPNCZSQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|