C22H31N3O3 — CID 170325363
3-[4-[4-[4-(hydroxymethyl)cyclohexyl]piperazin-1-yl]phenyl]piperidine-2,6-dione (PubChem CID 170325363) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is 3-[4-[4-[4-(hydroxymethyl)cyclohexyl]piperazin-1-yl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-[4-(hydroxymethyl)cyclohexyl]piperazin-1-yl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170325363 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 3-[4-[4-[4-(hydroxymethyl)cyclohexyl]piperazin-1-yl]phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2ccc(N3CCN(C4CCC(CO)CC4)CC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C22H31N3O3/c26-15-16-1-5-18(6-2-16)24-11-13-25(14-12-24)19-7-3-17(4-8-19)20-9-10-21(27)23-22(20)28/h3-4,7-8,16,18,20,26H,1-2,5-6,9-15H2,(H,23,27,28) |
| InChIKey | AEKVDKWTUXYJOM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|