About 2-[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperazin-1-yl]acetaldehyde;dihydrochloride
2-[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperazin-1-yl]acetaldehyde;dihydrochloride (PubChem CID 171820884) has the molecular formula C17H23Cl2N3O3
and a molecular weight of 388.30 g/mol. Its IUPAC name is 2-[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperazin-1-yl]acetaldehyde;dihydrochloride.
Molecular Properties
| Compound Name | 2-[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperazin-1-yl]acetaldehyde;dihydrochloride |
| PubChem CID | 171820884 |
| Molecular Formula | C17H23Cl2N3O3 |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 2-[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperazin-1-yl]acetaldehyde;dihydrochloride |
| SMILES | Cl.Cl.O=CCN1CCN(c2ccc(C3CCC(=O)NC3=O)cc2)CC1 |
| InChI | InChI=1S/C17H21N3O3.2ClH/c21-12-11-19-7-9-20(10-8-19)14-3-1-13(2-4-14)15-5-6-16(22)18-17(15)23;;/h1-4,12,15H,5-11H2,(H,18,22,23);2*1H |
| InChIKey | HALRFKHGLMUPQT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperazin-1-yl]acetaldehyde;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperazin-1-yl]acetaldehyde;dihydrochloride?
The IUPAC name of 2-[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperazin-1-yl]acetaldehyde;dihydrochloride (CID 171820884) is 2-[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperazin-1-yl]acetaldehyde;dihydrochloride.
What is the SMILES notation for 2-[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperazin-1-yl]acetaldehyde;dihydrochloride?
The canonical SMILES for 2-[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperazin-1-yl]acetaldehyde;dihydrochloride is Cl.Cl.O=CCN1CCN(c2ccc(C3CCC(=O)NC3=O)cc2)CC1.
What is the InChIKey of 2-[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperazin-1-yl]acetaldehyde;dihydrochloride?
The InChIKey is HALRFKHGLMUPQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O3.2ClH/c21-12-11-19-7-9-20(10-8-19)14-3-1-13(2-4-14)15-5-6-16(22)18-17(15)23;;/h1-4,12,15H,5-11H2,(H,18,22,23);2*1H.
What are the key properties of 2-[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperazin-1-yl]acetaldehyde;dihydrochloride?
2-[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperazin-1-yl]acetaldehyde;dihydrochloride has a molecular weight of 388.30 g/mol, XLogP of 1.37, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperazin-1-yl]acetaldehyde;dihydrochloride is sourced from PubChem (CID 171820884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).