C28H34N4O4 — CID 172570020
3-[4-[3-[2-[4-(3-aminophenoxy)piperidin-1-yl]-2-oxoethyl]pyrrolidin-1-yl]phenyl]piperidine-2,6-dione (PubChem CID 172570020) has the molecular formula C28H34N4O4 and a molecular weight of 490.60 g/mol. Its IUPAC name is 3-[4-[3-[2-[4-(3-aminophenoxy)piperidin-1-yl]-2-oxoethyl]pyrrolidin-1-yl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[3-[2-[4-(3-aminophenoxy)piperidin-1-yl]-2-oxoethyl]pyrrolidin-1-yl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 172570020 |
| Molecular Formula | C28H34N4O4 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | 3-[4-[3-[2-[4-(3-aminophenoxy)piperidin-1-yl]-2-oxoethyl]pyrrolidin-1-yl]phenyl]piperidine-2,6-dione |
| SMILES | Nc1cccc(OC2CCN(C(=O)CC3CCN(c4ccc(C5CCC(=O)NC5=O)cc4)C3)CC2)c1 |
| InChI | InChI=1S/C28H34N4O4/c29-21-2-1-3-24(17-21)36-23-11-14-31(15-12-23)27(34)16-19-10-13-32(18-19)22-6-4-20(5-7-22)25-8-9-26(33)30-28(25)35/h1-7,17,19,23,25H,8-16,18,29H2,(H,30,33,35) |
| InChIKey | XEEKIYDHFNYBPH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|