C19H26N2O3 — CID 170325392
3-[3-[4-(3-hydroxypropyl)piperidin-1-yl]phenyl]piperidine-2,6-dione (PubChem CID 170325392) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 3-[3-[4-(3-hydroxypropyl)piperidin-1-yl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[3-[4-(3-hydroxypropyl)piperidin-1-yl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170325392 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 3-[3-[4-(3-hydroxypropyl)piperidin-1-yl]phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2cccc(N3CCC(CCCO)CC3)c2)C(=O)N1 |
| InChI | InChI=1S/C19H26N2O3/c22-12-2-3-14-8-10-21(11-9-14)16-5-1-4-15(13-16)17-6-7-18(23)20-19(17)24/h1,4-5,13-14,17,22H,2-3,6-12H2,(H,20,23,24) |
| InChIKey | XYGBMXOJKIJURB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|