C22H32N4O2 — CID 177052731
3-[3-[9-(2-aminoethyl)-3,9-diazaspiro[5.5]undecan-3-yl]phenyl]piperidine-2,6-dione (PubChem CID 177052731) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 3-[3-[9-(2-aminoethyl)-3,9-diazaspiro[5.5]undecan-3-yl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[3-[9-(2-aminoethyl)-3,9-diazaspiro[5.5]undecan-3-yl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177052731 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 3-[3-[9-(2-aminoethyl)-3,9-diazaspiro[5.5]undecan-3-yl]phenyl]piperidine-2,6-dione |
| SMILES | NCCN1CCC2(CC1)CCN(c1cccc(C3CCC(=O)NC3=O)c1)CC2 |
| InChI | InChI=1S/C22H32N4O2/c23-10-15-25-11-6-22(7-12-25)8-13-26(14-9-22)18-3-1-2-17(16-18)19-4-5-20(27)24-21(19)28/h1-3,16,19H,4-15,23H2,(H,24,27,28) |
| InChIKey | FQNDPNUTLJLIRK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|