C28H41N3O2 — CID 177052114
3-[3-[4-[1-(cyclohexylmethyl)piperidin-4-yl]piperidin-1-yl]phenyl]piperidine-2,6-dione (PubChem CID 177052114) has the molecular formula C28H41N3O2 and a molecular weight of 451.66 g/mol. Its IUPAC name is 3-[3-[4-[1-(cyclohexylmethyl)piperidin-4-yl]piperidin-1-yl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[3-[4-[1-(cyclohexylmethyl)piperidin-4-yl]piperidin-1-yl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177052114 |
| Molecular Formula | C28H41N3O2 |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.32 |
| IUPAC Name | 3-[3-[4-[1-(cyclohexylmethyl)piperidin-4-yl]piperidin-1-yl]phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2cccc(N3CCC(C4CCN(CC5CCCCC5)CC4)CC3)c2)C(=O)N1 |
| InChI | InChI=1S/C28H41N3O2/c32-27-10-9-26(28(33)29-27)24-7-4-8-25(19-24)31-17-13-23(14-18-31)22-11-15-30(16-12-22)20-21-5-2-1-3-6-21/h4,7-8,19,21-23,26H,1-3,5-6,9-18,20H2,(H,29,32,33) |
| InChIKey | RVLBNWJJANTZIH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|