C26H37FN4O2 — CID 167463632
3-[4-[4-[(2-amino-7-azaspiro[3.5]nonan-7-yl)methyl]-4-methylpiperidin-1-yl]-3-fluorophenyl]piperidine-2,6-dione (PubChem CID 167463632) has the molecular formula C26H37FN4O2 and a molecular weight of 456.61 g/mol. Its IUPAC name is 3-[4-[4-[(2-amino-7-azaspiro[3.5]nonan-7-yl)methyl]-4-methylpiperidin-1-yl]-3-fluorophenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-[(2-amino-7-azaspiro[3.5]nonan-7-yl)methyl]-4-methylpiperidin-1-yl]-3-fluorophenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167463632 |
| Molecular Formula | C26H37FN4O2 |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | 3-[4-[4-[(2-amino-7-azaspiro[3.5]nonan-7-yl)methyl]-4-methylpiperidin-1-yl]-3-fluorophenyl]piperidine-2,6-dione |
| SMILES | CC1(CN2CCC3(CC2)CC(N)C3)CCN(c2ccc(C3CCC(=O)NC3=O)cc2F)CC1 |
| InChI | InChI=1S/C26H37FN4O2/c1-25(17-30-10-8-26(9-11-30)15-19(28)16-26)6-12-31(13-7-25)22-4-2-18(14-21(22)27)20-3-5-23(32)29-24(20)33/h2,4,14,19-20H,3,5-13,15-17,28H2,1H3,(H,29,32,33) |
| InChIKey | FYKNZFJXOOOZIS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|