C23H32FN5O3 — CID 167463458
3-[3-fluoro-4-[4-[(2S)-2-(1-nitrosopiperidin-4-yl)propyl]piperazin-1-yl]phenyl]piperidine-2,6-dione (PubChem CID 167463458) has the molecular formula C23H32FN5O3 and a molecular weight of 445.54 g/mol. Its IUPAC name is 3-[3-fluoro-4-[4-[(2S)-2-(1-nitrosopiperidin-4-yl)propyl]piperazin-1-yl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[3-fluoro-4-[4-[(2S)-2-(1-nitrosopiperidin-4-yl)propyl]piperazin-1-yl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167463458 |
| Molecular Formula | C23H32FN5O3 |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 3-[3-fluoro-4-[4-[(2S)-2-(1-nitrosopiperidin-4-yl)propyl]piperazin-1-yl]phenyl]piperidine-2,6-dione |
| SMILES | C[C@H](CN1CCN(c2ccc(C3CCC(=O)NC3=O)cc2F)CC1)C1CCN(N=O)CC1 |
| InChI | InChI=1S/C23H32FN5O3/c1-16(17-6-8-29(26-32)9-7-17)15-27-10-12-28(13-11-27)21-4-2-18(14-20(21)24)19-3-5-22(30)25-23(19)31/h2,4,14,16-17,19H,3,5-13,15H2,1H3,(H,25,30,31)/t16-,19?/m1/s1 |
| InChIKey | XSKULTAFRNKJMA-VTBWFHPJSA-N |
| XLogP | 2.50 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|