C24H33FN4O2 — CID 167463156
3-[4-[2-(4-aminopiperidin-1-yl)-7-azaspiro[3.5]nonan-7-yl]-3-fluorophenyl]piperidine-2,6-dione (PubChem CID 167463156) has the molecular formula C24H33FN4O2 and a molecular weight of 428.55 g/mol. Its IUPAC name is 3-[4-[2-(4-aminopiperidin-1-yl)-7-azaspiro[3.5]nonan-7-yl]-3-fluorophenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[2-(4-aminopiperidin-1-yl)-7-azaspiro[3.5]nonan-7-yl]-3-fluorophenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167463156 |
| Molecular Formula | C24H33FN4O2 |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 3-[4-[2-(4-aminopiperidin-1-yl)-7-azaspiro[3.5]nonan-7-yl]-3-fluorophenyl]piperidine-2,6-dione |
| SMILES | NC1CCN(C2CC3(CCN(c4ccc(C5CCC(=O)NC5=O)cc4F)CC3)C2)CC1 |
| InChI | InChI=1S/C24H33FN4O2/c25-20-13-16(19-2-4-22(30)27-23(19)31)1-3-21(20)29-11-7-24(8-12-29)14-18(15-24)28-9-5-17(26)6-10-28/h1,3,13,17-19H,2,4-12,14-15,26H2,(H,27,30,31) |
| InChIKey | INLSOZDUHZEZJU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|