C27H31FN4O4 — CID 175910989
N-[1-[1-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]azetidin-3-yl]piperidin-4-yl]-3-methoxybenzamide (PubChem CID 175910989) has the molecular formula C27H31FN4O4 and a molecular weight of 494.57 g/mol. Its IUPAC name is N-[1-[1-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]azetidin-3-yl]piperidin-4-yl]-3-methoxybenzamide.
| Compound Name | N-[1-[1-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]azetidin-3-yl]piperidin-4-yl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 175910989 |
| Molecular Formula | C27H31FN4O4 |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | N-[1-[1-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]azetidin-3-yl]piperidin-4-yl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NC2CCN(C3CN(c4ccc(C5CCC(=O)NC5=O)cc4F)C3)CC2)c1 |
| InChI | InChI=1S/C27H31FN4O4/c1-36-21-4-2-3-18(13-21)26(34)29-19-9-11-31(12-10-19)20-15-32(16-20)24-7-5-17(14-23(24)28)22-6-8-25(33)30-27(22)35/h2-5,7,13-14,19-20,22H,6,8-12,15-16H2,1H3,(H,29,34)(H,30,33,35) |
| InChIKey | DBZRZNYXNXISDC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|