C24H35FN4O2 — CID 167463189
3-[4-[4-[[(4-aminocyclohexyl)methylamino]methyl]piperidin-1-yl]-3-fluorophenyl]piperidine-2,6-dione (PubChem CID 167463189) has the molecular formula C24H35FN4O2 and a molecular weight of 430.57 g/mol. Its IUPAC name is 3-[4-[4-[[(4-aminocyclohexyl)methylamino]methyl]piperidin-1-yl]-3-fluorophenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-[[(4-aminocyclohexyl)methylamino]methyl]piperidin-1-yl]-3-fluorophenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167463189 |
| Molecular Formula | C24H35FN4O2 |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 3-[4-[4-[[(4-aminocyclohexyl)methylamino]methyl]piperidin-1-yl]-3-fluorophenyl]piperidine-2,6-dione |
| SMILES | NC1CCC(CNCC2CCN(c3ccc(C4CCC(=O)NC4=O)cc3F)CC2)CC1 |
| InChI | InChI=1S/C24H35FN4O2/c25-21-13-18(20-6-8-23(30)28-24(20)31)3-7-22(21)29-11-9-17(10-12-29)15-27-14-16-1-4-19(26)5-2-16/h3,7,13,16-17,19-20,27H,1-2,4-6,8-12,14-15,26H2,(H,28,30,31) |
| InChIKey | URKFGUBPPAPOQJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|