C23H32FN5O3 — CID 167463482
3-[4-[4-[3-(4-aminopiperidin-1-yl)-3-oxopropyl]piperazin-1-yl]-3-fluorophenyl]piperidine-2,6-dione (PubChem CID 167463482) has the molecular formula C23H32FN5O3 and a molecular weight of 445.54 g/mol. Its IUPAC name is 3-[4-[4-[3-(4-aminopiperidin-1-yl)-3-oxopropyl]piperazin-1-yl]-3-fluorophenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-[3-(4-aminopiperidin-1-yl)-3-oxopropyl]piperazin-1-yl]-3-fluorophenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167463482 |
| Molecular Formula | C23H32FN5O3 |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 3-[4-[4-[3-(4-aminopiperidin-1-yl)-3-oxopropyl]piperazin-1-yl]-3-fluorophenyl]piperidine-2,6-dione |
| SMILES | NC1CCN(C(=O)CCN2CCN(c3ccc(C4CCC(=O)NC4=O)cc3F)CC2)CC1 |
| InChI | InChI=1S/C23H32FN5O3/c24-19-15-16(18-2-4-21(30)26-23(18)32)1-3-20(19)28-13-11-27(12-14-28)8-7-22(31)29-9-5-17(25)6-10-29/h1,3,15,17-18H,2,4-14,25H2,(H,26,30,32) |
| InChIKey | QGRYRJPKEQGQDJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|