C23H31F2N3O2 — CID 177065318
3-[4-[4-(2-cyclohexylethyl)piperazin-1-yl]-3,5-difluorophenyl]piperidine-2,6-dione (PubChem CID 177065318) has the molecular formula C23H31F2N3O2 and a molecular weight of 419.52 g/mol. Its IUPAC name is 3-[4-[4-(2-cyclohexylethyl)piperazin-1-yl]-3,5-difluorophenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-(2-cyclohexylethyl)piperazin-1-yl]-3,5-difluorophenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177065318 |
| Molecular Formula | C23H31F2N3O2 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 3-[4-[4-(2-cyclohexylethyl)piperazin-1-yl]-3,5-difluorophenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2cc(F)c(N3CCN(CCC4CCCCC4)CC3)c(F)c2)C(=O)N1 |
| InChI | InChI=1S/C23H31F2N3O2/c24-19-14-17(18-6-7-21(29)26-23(18)30)15-20(25)22(19)28-12-10-27(11-13-28)9-8-16-4-2-1-3-5-16/h14-16,18H,1-13H2,(H,26,29,30) |
| InChIKey | QMMKNCNEEBBKOQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|