C23H35FN6O2 — CID 176897638
3-[[4-[4-[2-(1-aminopiperidin-4-yl)ethyl]piperazin-1-yl]-3-fluorophenyl]methylamino]piperidine-2,6-dione (PubChem CID 176897638) has the molecular formula C23H35FN6O2 and a molecular weight of 446.57 g/mol. Its IUPAC name is 3-[[4-[4-[2-(1-aminopiperidin-4-yl)ethyl]piperazin-1-yl]-3-fluorophenyl]methylamino]piperidine-2,6-dione.
| Compound Name | 3-[[4-[4-[2-(1-aminopiperidin-4-yl)ethyl]piperazin-1-yl]-3-fluorophenyl]methylamino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176897638 |
| Molecular Formula | C23H35FN6O2 |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | 3-[[4-[4-[2-(1-aminopiperidin-4-yl)ethyl]piperazin-1-yl]-3-fluorophenyl]methylamino]piperidine-2,6-dione |
| SMILES | NN1CCC(CCN2CCN(c3ccc(CNC4CCC(=O)NC4=O)cc3F)CC2)CC1 |
| InChI | InChI=1S/C23H35FN6O2/c24-19-15-18(16-26-20-2-4-22(31)27-23(20)32)1-3-21(19)29-13-11-28(12-14-29)8-5-17-6-9-30(25)10-7-17/h1,3,15,17,20,26H,2,4-14,16,25H2,(H,27,31,32) |
| InChIKey | LXNBUWPBGHOYTA-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|