C24H35N5O4 — CID 170004132
3-[5-[4-[3-(4-aminopiperidin-1-yl)-3-oxopropyl]piperazin-1-yl]-2-methoxyphenyl]piperidine-2,6-dione (PubChem CID 170004132) has the molecular formula C24H35N5O4 and a molecular weight of 457.58 g/mol. Its IUPAC name is 3-[5-[4-[3-(4-aminopiperidin-1-yl)-3-oxopropyl]piperazin-1-yl]-2-methoxyphenyl]piperidine-2,6-dione.
| Compound Name | 3-[5-[4-[3-(4-aminopiperidin-1-yl)-3-oxopropyl]piperazin-1-yl]-2-methoxyphenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170004132 |
| Molecular Formula | C24H35N5O4 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | 3-[5-[4-[3-(4-aminopiperidin-1-yl)-3-oxopropyl]piperazin-1-yl]-2-methoxyphenyl]piperidine-2,6-dione |
| SMILES | COc1ccc(N2CCN(CCC(=O)N3CCC(N)CC3)CC2)cc1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C24H35N5O4/c1-33-21-4-2-18(16-20(21)19-3-5-22(30)26-24(19)32)28-14-12-27(13-15-28)9-8-23(31)29-10-6-17(25)7-11-29/h2,4,16-17,19H,3,5-15,25H2,1H3,(H,26,30,32) |
| InChIKey | YRSOLIBSDRWGFO-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|