C16H26N6O — CID 39311838
1-(4-aminopiperidin-1-yl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one (PubChem CID 39311838) has the molecular formula C16H26N6O and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-(4-aminopiperidin-1-yl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one.
| Compound Name | 1-(4-aminopiperidin-1-yl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 39311838 |
| Molecular Formula | C16H26N6O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 1-(4-aminopiperidin-1-yl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one |
| SMILES | NC1CCN(C(=O)CCN2CCN(c3ncccn3)CC2)CC1 |
| InChI | InChI=1S/C16H26N6O/c17-14-2-8-21(9-3-14)15(23)4-7-20-10-12-22(13-11-20)16-18-5-1-6-19-16/h1,5-6,14H,2-4,7-13,17H2 |
| InChIKey | FECUETARDCIVCB-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |