C12H21Cl2N5O — CID 119827999
4-amino-1-(4-pyrimidin-2-ylpiperazin-1-yl)butan-1-one;dihydrochloride (PubChem CID 119827999) has the molecular formula C12H21Cl2N5O and a molecular weight of 322.24 g/mol. Its IUPAC name is 4-amino-1-(4-pyrimidin-2-ylpiperazin-1-yl)butan-1-one;dihydrochloride.
| Compound Name | 4-amino-1-(4-pyrimidin-2-ylpiperazin-1-yl)butan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 119827999 |
| Molecular Formula | C12H21Cl2N5O |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 4-amino-1-(4-pyrimidin-2-ylpiperazin-1-yl)butan-1-one;dihydrochloride |
| SMILES | Cl.Cl.NCCCC(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C12H19N5O.2ClH/c13-4-1-3-11(18)16-7-9-17(10-8-16)12-14-5-2-6-15-12;;/h2,5-6H,1,3-4,7-10,13H2;2*1H |
| InChIKey | PKYOLCYWHBLPDX-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |