C12H21Cl2N3OS — CID 119894828
4-amino-1-(4-thiophen-2-ylpiperazin-1-yl)butan-1-one;dihydrochloride (PubChem CID 119894828) has the molecular formula C12H21Cl2N3OS and a molecular weight of 326.29 g/mol. Its IUPAC name is 4-amino-1-(4-thiophen-2-ylpiperazin-1-yl)butan-1-one;dihydrochloride.
| Compound Name | 4-amino-1-(4-thiophen-2-ylpiperazin-1-yl)butan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 119894828 |
| Molecular Formula | C12H21Cl2N3OS |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 4-amino-1-(4-thiophen-2-ylpiperazin-1-yl)butan-1-one;dihydrochloride |
| SMILES | Cl.Cl.NCCCC(=O)N1CCN(c2cccs2)CC1 |
| InChI | InChI=1S/C12H19N3OS.2ClH/c13-5-1-3-11(16)14-6-8-15(9-7-14)12-4-2-10-17-12;;/h2,4,10H,1,3,5-9,13H2;2*1H |
| InChIKey | WZWYUGJWNMYJMN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |